C16H15FN2 — CID 155313290
2-(2-ethynyl-4-pyridinyl)-4-fluoro-6-propan-2-ylaniline (PubChem CID 155313290) has the molecular formula C16H15FN2 and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-(2-ethynyl-4-pyridinyl)-4-fluoro-6-propan-2-ylaniline.
| Compound Name | 2-(2-ethynyl-4-pyridinyl)-4-fluoro-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 155313290 |
| Molecular Formula | C16H15FN2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(2-ethynyl-4-pyridinyl)-4-fluoro-6-propan-2-ylaniline |
| SMILES | C#Cc1cc(-c2cc(F)cc(C(C)C)c2N)ccn1 |
| InChI | InChI=1S/C16H15FN2/c1-4-13-7-11(5-6-19-13)15-9-12(17)8-14(10(2)3)16(15)18/h1,5-10H,18H2,2-3H3 |
| InChIKey | PCXJNUWNWRIWQT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|