C28H32BBrF2N4O2 — CID 158186199
2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline;pyridin-4-ylboronic acid (PubChem CID 158186199) has the molecular formula C28H32BBrF2N4O2 and a molecular weight of 585.30 g/mol. Its IUPAC name is 2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline;pyridin-4-ylboronic acid.
| Compound Name | 2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline;pyridin-4-ylboronic acid |
|---|---|
| PubChem CID | 158186199 |
| Molecular Formula | C28H32BBrF2N4O2 |
| Molecular Weight | 585.30 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline;pyridin-4-ylboronic acid |
| SMILES | CC(C)c1cc(F)cc(-c2ccncc2)c1N.CC(C)c1cc(F)cc(Br)c1N.OB(O)c1ccncc1 |
| InChI | InChI=1S/C14H15FN2.C9H11BrFN.C5H6BNO2/c1-9(2)12-7-11(15)8-13(14(12)16)10-3-5-17-6-4-10;1-5(2)7-3-6(11)4-8(10)9(7)12;8-6(9)5-1-3-7-4-2-5/h3-9H,16H2,1-2H3;3-5H,12H2,1-2H3;1-4,8-9H |
| InChIKey | FZDYHMABJSPSAH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.30 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|