C23H30FIN4O3S — CID 137380156
1-(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)-3-(2-iodo-1-propan-2-ylpiperidin-4-yl)sulfonylurea (PubChem CID 137380156) has the molecular formula C23H30FIN4O3S and a molecular weight of 588.49 g/mol. Its IUPAC name is 1-(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)-3-(2-iodo-1-propan-2-ylpiperidin-4-yl)sulfonylurea.
| Compound Name | 1-(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)-3-(2-iodo-1-propan-2-ylpiperidin-4-yl)sulfonylurea |
|---|---|
| PubChem CID | 137380156 |
| Molecular Formula | C23H30FIN4O3S |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | 1-(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)-3-(2-iodo-1-propan-2-ylpiperidin-4-yl)sulfonylurea |
| SMILES | CC(C)c1cc(F)cc(-c2cccnc2)c1NC(=O)NS(=O)(=O)C1CCN(C(C)C)C(I)C1 |
| InChI | InChI=1S/C23H30FIN4O3S/c1-14(2)19-10-17(24)11-20(16-6-5-8-26-13-16)22(19)27-23(30)28-33(31,32)18-7-9-29(15(3)4)21(25)12-18/h5-6,8,10-11,13-15,18,21H,7,9,12H2,1-4H3,(H2,27,28,30) |
| InChIKey | VMZYPAHKKNXGOI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|