C18H21FN4S2 — CID 151894787
ethyl N'-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]carbamimidothioate (PubChem CID 151894787) has the molecular formula C18H21FN4S2 and a molecular weight of 376.53 g/mol. Its IUPAC name is ethyl N'-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]carbamimidothioate.
| Compound Name | ethyl N'-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 151894787 |
| Molecular Formula | C18H21FN4S2 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | ethyl N'-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]carbamimidothioate |
| SMILES | CCSC(N)=NC(=S)Nc1c(-c2cccnc2)cc(F)cc1C(C)C |
| InChI | InChI=1S/C18H21FN4S2/c1-4-25-17(20)23-18(24)22-16-14(11(2)3)8-13(19)9-15(16)12-6-5-7-21-10-12/h5-11H,4H2,1-3H3,(H3,20,22,23,24) |
| InChIKey | SRMHKCOPBFUCFV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|