C16H17FN4OS2 — CID 156695389
1-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]-3-sulfanylurea (PubChem CID 156695389) has the molecular formula C16H17FN4OS2 and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]-3-sulfanylurea.
| Compound Name | 1-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]-3-sulfanylurea |
|---|---|
| PubChem CID | 156695389 |
| Molecular Formula | C16H17FN4OS2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-[(4-fluoro-2-propan-2-yl-6-pyridin-3-ylphenyl)carbamothioyl]-3-sulfanylurea |
| SMILES | CC(C)c1cc(F)cc(-c2cccnc2)c1NC(=S)NC(=O)NS |
| InChI | InChI=1S/C16H17FN4OS2/c1-9(2)12-6-11(17)7-13(10-4-3-5-18-8-10)14(12)19-16(23)20-15(22)21-24/h3-9,24H,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | WYWBDZKMCSHIAY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|