C19H31N3O5S2 — CID 137403689
1-[2,6-di(propan-2-yl)phenyl]-3-(1-methylsulfonylpiperidin-4-yl)sulfonylurea (PubChem CID 137403689) has the molecular formula C19H31N3O5S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(1-methylsulfonylpiperidin-4-yl)sulfonylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(1-methylsulfonylpiperidin-4-yl)sulfonylurea |
|---|---|
| PubChem CID | 137403689 |
| Molecular Formula | C19H31N3O5S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(1-methylsulfonylpiperidin-4-yl)sulfonylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H31N3O5S2/c1-13(2)16-7-6-8-17(14(3)4)18(16)20-19(23)21-29(26,27)15-9-11-22(12-10-15)28(5,24)25/h6-8,13-15H,9-12H2,1-5H3,(H2,20,21,23) |
| InChIKey | JIOFXXGKPUXXBQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |