C16H23N3O4S — CID 155120921
1-[2,6-di(propan-2-yl)phenyl]-3-(4-oxoazetidin-2-yl)sulfonylurea (PubChem CID 155120921) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(4-oxoazetidin-2-yl)sulfonylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(4-oxoazetidin-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 155120921 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(4-oxoazetidin-2-yl)sulfonylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)C1CC(=O)N1 |
| InChI | InChI=1S/C16H23N3O4S/c1-9(2)11-6-5-7-12(10(3)4)15(11)18-16(21)19-24(22,23)14-8-13(20)17-14/h5-7,9-10,14H,8H2,1-4H3,(H,17,20)(H2,18,19,21) |
| InChIKey | PBHGAAITCMAZRD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |