C21H33N3O4S — CID 157470455
1-[2,6-di(propan-2-yl)phenyl]-3-(1-propanoylpiperidin-4-yl)sulfonylurea (PubChem CID 157470455) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(1-propanoylpiperidin-4-yl)sulfonylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(1-propanoylpiperidin-4-yl)sulfonylurea |
|---|---|
| PubChem CID | 157470455 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(1-propanoylpiperidin-4-yl)sulfonylurea |
| SMILES | CCC(=O)N1CCC(S(=O)(=O)NC(=O)Nc2c(C(C)C)cccc2C(C)C)CC1 |
| InChI | InChI=1S/C21H33N3O4S/c1-6-19(25)24-12-10-16(11-13-24)29(27,28)23-21(26)22-20-17(14(2)3)8-7-9-18(20)15(4)5/h7-9,14-16H,6,10-13H2,1-5H3,(H2,22,23,26) |
| InChIKey | MMRFQQXBJZEJAC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |