C18H27N3O4S — CID 155120677
1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxopiperidin-3-yl)sulfonylurea (PubChem CID 155120677) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxopiperidin-3-yl)sulfonylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxopiperidin-3-yl)sulfonylurea |
|---|---|
| PubChem CID | 155120677 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxopiperidin-3-yl)sulfonylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)C1CCCNC1=O |
| InChI | InChI=1S/C18H27N3O4S/c1-11(2)13-7-5-8-14(12(3)4)16(13)20-18(23)21-26(24,25)15-9-6-10-19-17(15)22/h5,7-8,11-12,15H,6,9-10H2,1-4H3,(H,19,22)(H2,20,21,23) |
| InChIKey | ZQJOXGFWTLBPMW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |