C17H22N4O3S — CID 155068943
1-[2,6-di(propan-2-yl)phenyl]-3-pyridazin-3-ylsulfonylurea (PubChem CID 155068943) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-pyridazin-3-ylsulfonylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-pyridazin-3-ylsulfonylurea |
|---|---|
| PubChem CID | 155068943 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-pyridazin-3-ylsulfonylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)c1cccnn1 |
| InChI | InChI=1S/C17H22N4O3S/c1-11(2)13-7-5-8-14(12(3)4)16(13)19-17(22)21-25(23,24)15-9-6-10-18-20-15/h5-12H,1-4H3,(H2,19,21,22) |
| InChIKey | GEODDKFUHHCRNZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |