C17H22N4NaO3S — CID 175753187
CID 175753187 (PubChem CID 175753187) has the molecular formula C17H22N4NaO3S and a molecular weight of 385.45 g/mol.
| Compound Name | CID 175753187 |
|---|---|
| PubChem CID | 175753187 |
| Molecular Formula | C17H22N4NaO3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)c1cnccn1.[Na] |
| InChI | InChI=1S/C17H22N4O3S.Na/c1-11(2)13-6-5-7-14(12(3)4)16(13)20-17(22)21-25(23,24)15-10-18-8-9-19-15;/h5-12H,1-4H3,(H2,20,21,22); |
| InChIKey | MLFOJGBSQQEXDO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |