C20H24N2O4S — CID 18461733
1-[2,6-di(propan-2-yl)phenyl]-3-(3-formylphenyl)sulfonylurea (PubChem CID 18461733) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(3-formylphenyl)sulfonylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(3-formylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 18461733 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(3-formylphenyl)sulfonylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=O)c1cccc(C=O)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-13(2)17-9-6-10-18(14(3)4)19(17)21-20(24)22-27(25,26)16-8-5-7-15(11-16)12-23/h5-14H,1-4H3,(H2,21,22,24) |
| InChIKey | XPPVIDUIDZGXHD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|