C18H24N4O3S — CID 137404425
1-[2,6-di(propan-2-yl)phenyl]-3-(5-methylpyrimidin-2-yl)sulfonylurea (PubChem CID 137404425) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(5-methylpyrimidin-2-yl)sulfonylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(5-methylpyrimidin-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 137404425 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(5-methylpyrimidin-2-yl)sulfonylurea |
| SMILES | Cc1cnc(S(=O)(=O)NC(=O)Nc2c(C(C)C)cccc2C(C)C)nc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-11(2)14-7-6-8-15(12(3)4)16(14)21-17(23)22-26(24,25)18-19-9-13(5)10-20-18/h6-12H,1-5H3,(H2,21,22,23) |
| InChIKey | CBHLUCQLTHBCGX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |