C19H26N4O3S — CID 155076568
1-(2,4-dimethylpyrimidin-5-yl)sulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 155076568) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-(2,4-dimethylpyrimidin-5-yl)sulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-(2,4-dimethylpyrimidin-5-yl)sulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 155076568 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-(2,4-dimethylpyrimidin-5-yl)sulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | Cc1ncc(S(=O)(=O)NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(C)n1 |
| InChI | InChI=1S/C19H26N4O3S/c1-11(2)15-8-7-9-16(12(3)4)18(15)22-19(24)23-27(25,26)17-10-20-14(6)21-13(17)5/h7-12H,1-6H3,(H2,22,23,24) |
| InChIKey | FRFPMMKKKURHKL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |