C28H24BrF6N3 — CID 167676009
4-(2-bromo-5,6-difluoro-3-propan-2-ylphenyl)-2-fluoropyridine;3,4-difluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylaniline (PubChem CID 167676009) has the molecular formula C28H24BrF6N3 and a molecular weight of 596.41 g/mol. Its IUPAC name is 4-(2-bromo-5,6-difluoro-3-propan-2-ylphenyl)-2-fluoropyridine;3,4-difluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylaniline.
| Compound Name | 4-(2-bromo-5,6-difluoro-3-propan-2-ylphenyl)-2-fluoropyridine;3,4-difluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 167676009 |
| Molecular Formula | C28H24BrF6N3 |
| Molecular Weight | 596.41 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | 4-(2-bromo-5,6-difluoro-3-propan-2-ylphenyl)-2-fluoropyridine;3,4-difluoro-2-(2-fluoro-4-pyridinyl)-6-propan-2-ylaniline |
| SMILES | CC(C)c1cc(F)c(F)c(-c2ccnc(F)c2)c1Br.CC(C)c1cc(F)c(F)c(-c2ccnc(F)c2)c1N |
| InChI | InChI=1S/C14H11BrF3N.C14H13F3N2/c1-7(2)9-6-10(16)14(18)12(13(9)15)8-3-4-19-11(17)5-8;1-7(2)9-6-10(15)13(17)12(14(9)18)8-3-4-19-11(16)5-8/h3-7H,1-2H3;3-7H,18H2,1-2H3 |
| InChIKey | UUZKXORQZHSLKL-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.41 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|