C11H3F6N — CID 133088728
2-fluoro-4-(2,3,4,5,6-pentafluorophenyl)pyridine (PubChem CID 133088728) has the molecular formula C11H3F6N and a molecular weight of 263.14 g/mol. Its IUPAC name is 2-fluoro-4-(2,3,4,5,6-pentafluorophenyl)pyridine.
| Compound Name | 2-fluoro-4-(2,3,4,5,6-pentafluorophenyl)pyridine |
|---|---|
| PubChem CID | 133088728 |
| Molecular Formula | C11H3F6N |
| Molecular Weight | 263.14 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 2-fluoro-4-(2,3,4,5,6-pentafluorophenyl)pyridine |
| SMILES | Fc1cc(-c2c(F)c(F)c(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C11H3F6N/c12-5-3-4(1-2-18-5)6-7(13)9(15)11(17)10(16)8(6)14/h1-3H |
| InChIKey | QVBBPTHOWGBGCE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|