C38H22F4N4 — CID 132917715
4-[3-[3-(3,5-dipyridin-4-ylphenyl)-2,4,5,6-tetrafluorophenyl]-5-pyridin-4-ylphenyl]pyridine (PubChem CID 132917715) has the molecular formula C38H22F4N4 and a molecular weight of 610.61 g/mol. Its IUPAC name is 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-2,4,5,6-tetrafluorophenyl]-5-pyridin-4-ylphenyl]pyridine.
| Compound Name | 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-2,4,5,6-tetrafluorophenyl]-5-pyridin-4-ylphenyl]pyridine |
|---|---|
| PubChem CID | 132917715 |
| Molecular Formula | C38H22F4N4 |
| Molecular Weight | 610.61 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-2,4,5,6-tetrafluorophenyl]-5-pyridin-4-ylphenyl]pyridine |
| SMILES | Fc1c(F)c(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)c(F)c(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)c1F |
| InChI | InChI=1S/C38H22F4N4/c39-35-33(31-19-27(23-1-9-43-10-2-23)17-28(20-31)24-3-11-44-12-4-24)36(40)38(42)37(41)34(35)32-21-29(25-5-13-45-14-6-25)18-30(22-32)26-7-15-46-16-8-26/h1-22H |
| InChIKey | CVTFAFJWPTXZBF-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.61 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|