C11H5F4N — CID 46317135
4-(2,3,4,6-tetrafluorophenyl)pyridine (PubChem CID 46317135) has the molecular formula C11H5F4N and a molecular weight of 227.16 g/mol. Its IUPAC name is 4-(2,3,4,6-tetrafluorophenyl)pyridine.
| Compound Name | 4-(2,3,4,6-tetrafluorophenyl)pyridine |
|---|---|
| PubChem CID | 46317135 |
| Molecular Formula | C11H5F4N |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-(2,3,4,6-tetrafluorophenyl)pyridine |
| SMILES | Fc1cc(F)c(-c2ccncc2)c(F)c1F |
| InChI | InChI=1S/C11H5F4N/c12-7-5-8(13)10(14)11(15)9(7)6-1-3-16-4-2-6/h1-5H |
| InChIKey | MLEODPHNDYEQDQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|