C12H8FN3 — CID 121014694
7-(2-fluoro-4-pyridinyl)imidazo[1,2-a]pyridine (PubChem CID 121014694) has the molecular formula C12H8FN3 and a molecular weight of 213.22 g/mol. Its IUPAC name is 7-(2-fluoro-4-pyridinyl)imidazo[1,2-a]pyridine.
| Compound Name | 7-(2-fluoro-4-pyridinyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 121014694 |
| Molecular Formula | C12H8FN3 |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 7-(2-fluoro-4-pyridinyl)imidazo[1,2-a]pyridine |
| SMILES | Fc1cc(-c2ccn3ccnc3c2)ccn1 |
| InChI | InChI=1S/C12H8FN3/c13-11-7-9(1-3-14-11)10-2-5-16-6-4-15-12(16)8-10/h1-8H |
| InChIKey | SHROEBLWCQQVLV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|