C9H3BrF3N — CID 114764064
4-bromo-5,6,7-trifluoroquinoline (PubChem CID 114764064) has the molecular formula C9H3BrF3N and a molecular weight of 262.03 g/mol. Its IUPAC name is 4-bromo-5,6,7-trifluoroquinoline.
| Compound Name | 4-bromo-5,6,7-trifluoroquinoline |
|---|---|
| PubChem CID | 114764064 |
| Molecular Formula | C9H3BrF3N |
| Molecular Weight | 262.03 g/mol |
| Exact Mass | 260.94 |
| IUPAC Name | 4-bromo-5,6,7-trifluoroquinoline |
| SMILES | Fc1cc2nccc(Br)c2c(F)c1F |
| InChI | InChI=1S/C9H3BrF3N/c10-4-1-2-14-6-3-5(11)8(12)9(13)7(4)6/h1-3H |
| InChIKey | OYNIIIXNWFLJMW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.03 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|