C9H4Br2FN — CID 107627841
4,8-dibromo-5-fluoroquinoline (PubChem CID 107627841) has the molecular formula C9H4Br2FN and a molecular weight of 304.94 g/mol. Its IUPAC name is 4,8-dibromo-5-fluoroquinoline.
| Compound Name | 4,8-dibromo-5-fluoroquinoline |
|---|---|
| PubChem CID | 107627841 |
| Molecular Formula | C9H4Br2FN |
| Molecular Weight | 304.94 g/mol |
| Exact Mass | 302.87 |
| IUPAC Name | 4,8-dibromo-5-fluoroquinoline |
| SMILES | Fc1ccc(Br)c2nccc(Br)c12 |
| InChI | InChI=1S/C9H4Br2FN/c10-5-3-4-13-9-6(11)1-2-7(12)8(5)9/h1-4H |
| InChIKey | QMBFFTSHRCCDDM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |