C9H4Br3N — CID 114764035
4,5,8-tribromoquinoline (PubChem CID 114764035) has the molecular formula C9H4Br3N and a molecular weight of 365.85 g/mol. Its IUPAC name is 4,5,8-tribromoquinoline.
| Compound Name | 4,5,8-tribromoquinoline |
|---|---|
| PubChem CID | 114764035 |
| Molecular Formula | C9H4Br3N |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 362.79 |
| IUPAC Name | 4,5,8-tribromoquinoline |
| SMILES | Brc1ccc(Br)c2c(Br)ccnc12 |
| InChI | InChI=1S/C9H4Br3N/c10-5-1-2-7(12)9-8(5)6(11)3-4-13-9/h1-4H |
| InChIKey | XMZOOPARDSBQQR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |