C13H8Br2N2 — CID 102458232
4,6-dibromo-10-methylpyrido[3,2-g]quinoline (PubChem CID 102458232) has the molecular formula C13H8Br2N2 and a molecular weight of 352.03 g/mol. Its IUPAC name is 4,6-dibromo-10-methylpyrido[3,2-g]quinoline.
| Compound Name | 4,6-dibromo-10-methylpyrido[3,2-g]quinoline |
|---|---|
| PubChem CID | 102458232 |
| Molecular Formula | C13H8Br2N2 |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 4,6-dibromo-10-methylpyrido[3,2-g]quinoline |
| SMILES | Cc1c2nccc(Br)c2cc2c(Br)ccnc12 |
| InChI | InChI=1S/C13H8Br2N2/c1-7-12-8(10(14)2-4-16-12)6-9-11(15)3-5-17-13(7)9/h2-6H,1H3 |
| InChIKey | HYLVUGXEJXMQBI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|