C17H12BrF2NO — CID 118870226
4-bromo-6-[(2,6-difluorophenyl)methoxy]-8-methylquinoline (PubChem CID 118870226) has the molecular formula C17H12BrF2NO and a molecular weight of 364.19 g/mol. Its IUPAC name is 4-bromo-6-[(2,6-difluorophenyl)methoxy]-8-methylquinoline.
| Compound Name | 4-bromo-6-[(2,6-difluorophenyl)methoxy]-8-methylquinoline |
|---|---|
| PubChem CID | 118870226 |
| Molecular Formula | C17H12BrF2NO |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 4-bromo-6-[(2,6-difluorophenyl)methoxy]-8-methylquinoline |
| SMILES | Cc1cc(OCc2c(F)cccc2F)cc2c(Br)ccnc12 |
| InChI | InChI=1S/C17H12BrF2NO/c1-10-7-11(8-12-14(18)5-6-21-17(10)12)22-9-13-15(19)3-2-4-16(13)20/h2-8H,9H2,1H3 |
| InChIKey | OGBSQEYGZWIUBS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |