C13H9BrF3NO — CID 103482967
5-bromo-2-[(2,6-difluorophenyl)methoxy]-4-fluoroaniline (PubChem CID 103482967) has the molecular formula C13H9BrF3NO and a molecular weight of 332.12 g/mol. Its IUPAC name is 5-bromo-2-[(2,6-difluorophenyl)methoxy]-4-fluoroaniline.
| Compound Name | 5-bromo-2-[(2,6-difluorophenyl)methoxy]-4-fluoroaniline |
|---|---|
| PubChem CID | 103482967 |
| Molecular Formula | C13H9BrF3NO |
| Molecular Weight | 332.12 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 5-bromo-2-[(2,6-difluorophenyl)methoxy]-4-fluoroaniline |
| SMILES | Nc1cc(Br)c(F)cc1OCc1c(F)cccc1F |
| InChI | InChI=1S/C13H9BrF3NO/c14-8-4-12(18)13(5-11(8)17)19-6-7-9(15)2-1-3-10(7)16/h1-5H,6,18H2 |
| InChIKey | VCPKYMYQMYZONX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.12 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|