C13H9F4NO — CID 58022350
5-[(2,6-difluorophenyl)methoxy]-2,4-difluoroaniline (PubChem CID 58022350) has the molecular formula C13H9F4NO and a molecular weight of 271.21 g/mol. Its IUPAC name is 5-[(2,6-difluorophenyl)methoxy]-2,4-difluoroaniline.
| Compound Name | 5-[(2,6-difluorophenyl)methoxy]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 58022350 |
| Molecular Formula | C13H9F4NO |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-[(2,6-difluorophenyl)methoxy]-2,4-difluoroaniline |
| SMILES | Nc1cc(OCc2c(F)cccc2F)c(F)cc1F |
| InChI | InChI=1S/C13H9F4NO/c14-8-2-1-3-9(15)7(8)6-19-13-5-12(18)10(16)4-11(13)17/h1-5H,6,18H2 |
| InChIKey | XGGYGJHNQRQRRV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|