C15H10FN3 — CID 46316529
5-fluoro-2,3-dipyridin-3-ylpyridine (PubChem CID 46316529) has the molecular formula C15H10FN3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 5-fluoro-2,3-dipyridin-3-ylpyridine.
| Compound Name | 5-fluoro-2,3-dipyridin-3-ylpyridine |
|---|---|
| PubChem CID | 46316529 |
| Molecular Formula | C15H10FN3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-fluoro-2,3-dipyridin-3-ylpyridine |
| SMILES | Fc1cnc(-c2cccnc2)c(-c2cccnc2)c1 |
| InChI | InChI=1S/C15H10FN3/c16-13-7-14(11-3-1-5-17-8-11)15(19-10-13)12-4-2-6-18-9-12/h1-10H |
| InChIKey | KWSPGIMXNIHSII-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |