About 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride
2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride (PubChem CID 175008055) has the molecular formula C15H11Cl3N3Ru
and a molecular weight of 440.70 g/mol. Its IUPAC name is 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride.
Molecular Properties
| Compound Name | 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride |
| PubChem CID | 175008055 |
| Molecular Formula | C15H11Cl3N3Ru |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 439.91 |
| IUPAC Name | 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Ru+3].c1cncc(-c2cccnc2-c2cccnc2)c1 |
| InChI | InChI=1S/C15H11N3.3ClH.Ru/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;;;;/h1-11H;3*1H;/q;;;;+3/p-3 |
| InChIKey | MZSYXKGZDJWGGR-UHFFFAOYSA-K |
| XLogP | -5.78 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride?
The IUPAC name of 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride (CID 175008055) is 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride.
What is the SMILES notation for 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride?
The canonical SMILES for 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride is [Cl-].[Cl-].[Cl-].[Ru+3].c1cncc(-c2cccnc2-c2cccnc2)c1.
What is the InChIKey of 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride?
The InChIKey is MZSYXKGZDJWGGR-UHFFFAOYSA-K. The full InChI is InChI=1S/C15H11N3.3ClH.Ru/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;;;;/h1-11H;3*1H;/q;;;;+3/p-3.
What are the key properties of 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride?
2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride has a molecular weight of 440.70 g/mol, XLogP of -5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipyridin-3-ylpyridine;ruthenium(3+);trichloride is sourced from PubChem (CID 175008055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).