About 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide
2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide (PubChem CID 175132894) has the molecular formula C15H11Br2N3Pt
and a molecular weight of 588.16 g/mol. Its IUPAC name is 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide.
Molecular Properties
| Compound Name | 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide |
| PubChem CID | 175132894 |
| Molecular Formula | C15H11Br2N3Pt |
| Molecular Weight | 588.16 g/mol |
| Exact Mass | 585.90 |
| IUPAC Name | 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide |
| SMILES | [Br-].[Br-].[Pt+2].c1cncc(-c2cccnc2-c2cccnc2)c1 |
| InChI | InChI=1S/C15H11N3.2BrH.Pt/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;;;/h1-11H;2*1H;/q;;;+2/p-2 |
| InChIKey | WOTQSAUAJJBVTI-UHFFFAOYSA-L |
| XLogP | -2.79 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 588.16 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide?
The IUPAC name of 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide (CID 175132894) is 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide.
What is the SMILES notation for 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide?
The canonical SMILES for 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide is [Br-].[Br-].[Pt+2].c1cncc(-c2cccnc2-c2cccnc2)c1.
What is the InChIKey of 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide?
The InChIKey is WOTQSAUAJJBVTI-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H11N3.2BrH.Pt/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;;;/h1-11H;2*1H;/q;;;+2/p-2.
What are the key properties of 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide?
2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide has a molecular weight of 588.16 g/mol, XLogP of -2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipyridin-3-ylpyridine;platinum(2+);dibromide is sourced from PubChem (CID 175132894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).