C20H23N — CID 116698555
4-(4-cyclohexylphenyl)-2,3-dihydro-1H-indole (PubChem CID 116698555) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-(4-cyclohexylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(4-cyclohexylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698555 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-(4-cyclohexylphenyl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(c(-c3ccc(C4CCCCC4)cc3)c1)CCN2 |
| InChI | InChI=1S/C20H23N/c1-2-5-15(6-3-1)16-9-11-17(12-10-16)18-7-4-8-20-19(18)13-14-21-20/h4,7-12,15,21H,1-3,5-6,13-14H2 |
| InChIKey | FGNRJTMZBFJJFB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |