C22H21ClN2 — CID 22397013
10-naphthalen-2-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride (PubChem CID 22397013) has the molecular formula C22H21ClN2 and a molecular weight of 348.88 g/mol. Its IUPAC name is 10-naphthalen-2-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride.
| Compound Name | 10-naphthalen-2-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
|---|---|
| PubChem CID | 22397013 |
| Molecular Formula | C22H21ClN2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 10-naphthalen-2-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
| SMILES | Cl.c1ccc2cc(-c3cccc4[nH]c5c(c34)CCNCC5)ccc2c1 |
| InChI | InChI=1S/C22H20N2.ClH/c1-2-5-16-14-17(9-8-15(16)4-1)18-6-3-7-21-22(18)19-10-12-23-13-11-20(19)24-21;/h1-9,14,23-24H,10-13H2;1H |
| InChIKey | QLJYKOMEXQSSDT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |