C22H25ClN2O3 — CID 22396657
10-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride (PubChem CID 22396657) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 10-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride.
| Compound Name | 10-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
|---|---|
| PubChem CID | 22396657 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 10-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
| SMILES | Cl.c1cc(CCCOc2ccc3c(c2)OCO3)c2c3c([nH]c2c1)CCNCC3 |
| InChI | InChI=1S/C22H24N2O3.ClH/c1-3-15(22-17-8-10-23-11-9-18(17)24-19(22)5-1)4-2-12-25-16-6-7-20-21(13-16)27-14-26-20;/h1,3,5-7,13,23-24H,2,4,8-12,14H2;1H |
| InChIKey | JGUBXLNIQHGOGS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|