C25H34N2O — CID 142130625
10-[3-(2,4-dimethylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;ethane (PubChem CID 142130625) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 10-[3-(2,4-dimethylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;ethane.
| Compound Name | 10-[3-(2,4-dimethylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;ethane |
|---|---|
| PubChem CID | 142130625 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 10-[3-(2,4-dimethylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;ethane |
| SMILES | CC.Cc1ccc(OCCCc2cccc3[nH]c4c(c23)CCNCC4)c(C)c1 |
| InChI | InChI=1S/C23H28N2O.C2H6/c1-16-8-9-22(17(2)15-16)26-14-4-6-18-5-3-7-21-23(18)19-10-12-24-13-11-20(19)25-21;1-2/h3,5,7-9,15,24-25H,4,6,10-14H2,1-2H3;1-2H3 |
| InChIKey | GOIWHVGHXBRCJZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|