C16H24N2 — CID 142960260
ethane;8-methyl-2,3,4,5,6,11-hexahydro-1H-azocino[4,5-b]indole (PubChem CID 142960260) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is ethane;8-methyl-2,3,4,5,6,11-hexahydro-1H-azocino[4,5-b]indole.
| Compound Name | ethane;8-methyl-2,3,4,5,6,11-hexahydro-1H-azocino[4,5-b]indole |
|---|---|
| PubChem CID | 142960260 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | ethane;8-methyl-2,3,4,5,6,11-hexahydro-1H-azocino[4,5-b]indole |
| SMILES | CC.Cc1ccc2[nH]c3c(c2c1)CCCNCC3 |
| InChI | InChI=1S/C14H18N2.C2H6/c1-10-4-5-13-12(9-10)11-3-2-7-15-8-6-14(11)16-13;1-2/h4-5,9,15-16H,2-3,6-8H2,1H3;1-2H3 |
| InChIKey | SSFGVIKVZIVLPT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|