C12H13NO — CID 172623216
6-methyl-2,3,4,9-tetrahydropyrano[2,3-b]indole (PubChem CID 172623216) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 6-methyl-2,3,4,9-tetrahydropyrano[2,3-b]indole.
| Compound Name | 6-methyl-2,3,4,9-tetrahydropyrano[2,3-b]indole |
|---|---|
| PubChem CID | 172623216 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 6-methyl-2,3,4,9-tetrahydropyrano[2,3-b]indole |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCCO3 |
| InChI | InChI=1S/C12H13NO/c1-8-4-5-11-10(7-8)9-3-2-6-14-12(9)13-11/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | SYSRQDJZBMKFSC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |