C17H17N3 — CID 21129383
9-pyridin-4-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole (PubChem CID 21129383) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 9-pyridin-4-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole.
| Compound Name | 9-pyridin-4-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 21129383 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 9-pyridin-4-yl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
| SMILES | c1cc(-c2ccc3[nH]c4c(c3c2)CCNCC4)ccn1 |
| InChI | InChI=1S/C17H17N3/c1-2-16-15(11-13(1)12-3-7-18-8-4-12)14-5-9-19-10-6-17(14)20-16/h1-4,7-8,11,19-20H,5-6,9-10H2 |
| InChIKey | UPEPNFPEYFVLHM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|