C19H19FN2 — CID 143634223
10-(3-fluorophenyl)-2,3,4,5,6,7-hexahydro-1H-azocino[4,3-b]indole (PubChem CID 143634223) has the molecular formula C19H19FN2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 10-(3-fluorophenyl)-2,3,4,5,6,7-hexahydro-1H-azocino[4,3-b]indole.
| Compound Name | 10-(3-fluorophenyl)-2,3,4,5,6,7-hexahydro-1H-azocino[4,3-b]indole |
|---|---|
| PubChem CID | 143634223 |
| Molecular Formula | C19H19FN2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 10-(3-fluorophenyl)-2,3,4,5,6,7-hexahydro-1H-azocino[4,3-b]indole |
| SMILES | Fc1cccc(-c2ccc3[nH]c4c(c3c2)CNCCCC4)c1 |
| InChI | InChI=1S/C19H19FN2/c20-15-5-3-4-13(10-15)14-7-8-19-16(11-14)17-12-21-9-2-1-6-18(17)22-19/h3-5,7-8,10-11,21-22H,1-2,6,9,12H2 |
| InChIKey | OMLCTMCSQRWKPI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|