About 5-(3-fluorophenyl)-2,3-dihydro-1H-indene
5-(3-fluorophenyl)-2,3-dihydro-1H-indene (PubChem CID 54342765) has the molecular formula C15H13F
and a molecular weight of 212.27 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-(3-fluorophenyl)-2,3-dihydro-1H-indene |
| PubChem CID | 54342765 |
| Molecular Formula | C15H13F |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-(3-fluorophenyl)-2,3-dihydro-1H-indene |
| SMILES | Fc1cccc(-c2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C15H13F/c16-15-6-2-5-13(10-15)14-8-7-11-3-1-4-12(11)9-14/h2,5-10H,1,3-4H2 |
| InChIKey | SOXXPUBICQMIQM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-(3-fluorophenyl)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenyl)-2,3-dihydro-1H-indene?
The IUPAC name of 5-(3-fluorophenyl)-2,3-dihydro-1H-indene (CID 54342765) is 5-(3-fluorophenyl)-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-(3-fluorophenyl)-2,3-dihydro-1H-indene?
The canonical SMILES for 5-(3-fluorophenyl)-2,3-dihydro-1H-indene is Fc1cccc(-c2ccc3c(c2)CCC3)c1.
What is the InChIKey of 5-(3-fluorophenyl)-2,3-dihydro-1H-indene?
The InChIKey is SOXXPUBICQMIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F/c16-15-6-2-5-13(10-15)14-8-7-11-3-1-4-12(11)9-14/h2,5-10H,1,3-4H2.
What are the key properties of 5-(3-fluorophenyl)-2,3-dihydro-1H-indene?
5-(3-fluorophenyl)-2,3-dihydro-1H-indene has a molecular weight of 212.27 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenyl)-2,3-dihydro-1H-indene is sourced from PubChem (CID 54342765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).