C13H16N2O2 — CID 143296449
methane;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 143296449) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is methane;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | methane;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 143296449 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | methane;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | C.O=C(O)c1ccc2[nH]c3c(c2c1)CNCC3 |
| InChI | InChI=1S/C12H12N2O2.CH4/c15-12(16)7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10;/h1-2,5,13-14H,3-4,6H2,(H,15,16);1H4 |
| InChIKey | LZRYMEYDXAMQFB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|