C12H12N2O2 — CID 83886993
2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6-carboxylic acid (PubChem CID 83886993) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6-carboxylic acid.
| Compound Name | 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 83886993 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c3c(c2c1)CCNC3 |
| InChI | InChI=1S/C12H12N2O2/c15-12(16)7-1-2-10-9(5-7)8-3-4-13-6-11(8)14-10/h1-2,5,13-14H,3-4,6H2,(H,15,16) |
| InChIKey | ZBSPIRVLLGTJJZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|