C23H25FN4O — CID 23377647
[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)methanone (PubChem CID 23377647) has the molecular formula C23H25FN4O and a molecular weight of 392.48 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)methanone.
| Compound Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)methanone |
|---|---|
| PubChem CID | 23377647 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)methanone |
| SMILES | O=C(c1ccc2[nH]c3c(c2c1)CCNC3)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H25FN4O/c24-18-4-1-16(2-5-18)15-27-9-11-28(12-10-27)23(29)17-3-6-21-20(13-17)19-7-8-25-14-22(19)26-21/h1-6,13,25-26H,7-12,14-15H2 |
| InChIKey | UHWPIAGHRLJKOP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|