C19H22FN3O — CID 119838903
(3-aminophenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone (PubChem CID 119838903) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is (3-aminophenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | (3-aminophenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 119838903 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (3-aminophenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone |
| SMILES | Nc1cccc(C(=O)N2CCCN(Cc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C19H22FN3O/c20-17-7-5-15(6-8-17)14-22-9-2-10-23(12-11-22)19(24)16-3-1-4-18(21)13-16/h1,3-8,13H,2,9-12,14,21H2 |
| InChIKey | ZFBLNQGHDVVIAE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|