C19H23ClFN3O2 — CID 154914602
(2-amino-5-hydroxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone;hydrochloride (PubChem CID 154914602) has the molecular formula C19H23ClFN3O2 and a molecular weight of 379.86 g/mol. Its IUPAC name is (2-amino-5-hydroxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone;hydrochloride.
| Compound Name | (2-amino-5-hydroxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154914602 |
| Molecular Formula | C19H23ClFN3O2 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2-amino-5-hydroxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone;hydrochloride |
| SMILES | Cl.Nc1ccc(O)cc1C(=O)N1CCCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H22FN3O2.ClH/c20-15-4-2-14(3-5-15)13-22-8-1-9-23(11-10-22)19(25)17-12-16(24)6-7-18(17)21;/h2-7,12,24H,1,8-11,13,21H2;1H |
| InChIKey | UWDDMLALYVGGOQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|