C20H23ClFN3O2 — CID 119838920
(4-amino-5-chloro-2-methoxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone (PubChem CID 119838920) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 119838920 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H23ClFN3O2/c1-27-19-12-18(23)17(21)11-16(19)20(26)25-8-2-7-24(9-10-25)13-14-3-5-15(22)6-4-14/h3-6,11-12H,2,7-10,13,23H2,1H3 |
| InChIKey | FOAOUUPTKRUXBJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|