C17H21ClN4O3 — CID 119835219
(4-amino-5-chloro-2-methoxyphenyl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-1-yl]methanone (PubChem CID 119835219) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119835219 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCN(Cc2cc(C)on2)CC1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-11-7-12(20-25-11)10-21-3-5-22(6-4-21)17(23)13-8-14(18)15(19)9-16(13)24-2/h7-9H,3-6,10,19H2,1-2H3 |
| InChIKey | OSYSIMLJYZRILD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|