C17H19Cl2N3O4 — CID 119673070
[4-(4-amino-5-chloro-2-methoxybenzoyl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride (PubChem CID 119673070) has the molecular formula C17H19Cl2N3O4 and a molecular weight of 400.26 g/mol. Its IUPAC name is [4-(4-amino-5-chloro-2-methoxybenzoyl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride.
| Compound Name | [4-(4-amino-5-chloro-2-methoxybenzoyl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119673070 |
| Molecular Formula | C17H19Cl2N3O4 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [4-(4-amino-5-chloro-2-methoxybenzoyl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCN(C(=O)c2ccco2)CC1.Cl |
| InChI | InChI=1S/C17H18ClN3O4.ClH/c1-24-15-10-13(19)12(18)9-11(15)16(22)20-4-6-21(7-5-20)17(23)14-3-2-8-25-14;/h2-3,8-10H,4-7,19H2,1H3;1H |
| InChIKey | IVKJOPKPVHSVAI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|