C19H22Cl2N2O3 — CID 119725126
(4-amino-5-chloro-2-methoxyphenyl)-(4-phenoxypiperidin-1-yl)methanone;hydrochloride (PubChem CID 119725126) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-(4-phenoxypiperidin-1-yl)methanone;hydrochloride.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-(4-phenoxypiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119725126 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-(4-phenoxypiperidin-1-yl)methanone;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCC(Oc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C19H21ClN2O3.ClH/c1-24-18-12-17(21)16(20)11-15(18)19(23)22-9-7-14(8-10-22)25-13-5-3-2-4-6-13;/h2-6,11-12,14H,7-10,21H2,1H3;1H |
| InChIKey | HLJCNBPHYRSGTP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|