C16H25Cl2N3O4S — CID 119780867
N-[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-4-yl]-N-ethylmethanesulfonamide;hydrochloride (PubChem CID 119780867) has the molecular formula C16H25Cl2N3O4S and a molecular weight of 426.37 g/mol. Its IUPAC name is N-[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-4-yl]-N-ethylmethanesulfonamide;hydrochloride.
| Compound Name | N-[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-4-yl]-N-ethylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119780867 |
| Molecular Formula | C16H25Cl2N3O4S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-4-yl]-N-ethylmethanesulfonamide;hydrochloride |
| SMILES | CCN(C1CCN(C(=O)c2cc(Cl)c(N)cc2OC)CC1)S(C)(=O)=O.Cl |
| InChI | InChI=1S/C16H24ClN3O4S.ClH/c1-4-20(25(3,22)23)11-5-7-19(8-6-11)16(21)12-9-13(17)14(18)10-15(12)24-2;/h9-11H,4-8,18H2,1-3H3;1H |
| InChIKey | UQJINWKCDVIALY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|