C15H21ClN2O3 — CID 119781775
(4-amino-5-chloro-2-methoxyphenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone (PubChem CID 119781775) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119781775 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone |
| SMILES | COCC1CCCN(C(=O)c2cc(Cl)c(N)cc2OC)C1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-20-9-10-4-3-5-18(8-10)15(19)11-6-12(16)13(17)7-14(11)21-2/h6-7,10H,3-5,8-9,17H2,1-2H3 |
| InChIKey | RGHRSTIBRSFLIO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|