C18H26ClN3O3 — CID 119761665
N-[[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-3-yl]methyl]butanamide (PubChem CID 119761665) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is N-[[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-3-yl]methyl]butanamide.
| Compound Name | N-[[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 119761665 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[[1-(4-amino-5-chloro-2-methoxybenzoyl)piperidin-3-yl]methyl]butanamide |
| SMILES | CCCC(=O)NCC1CCCN(C(=O)c2cc(Cl)c(N)cc2OC)C1 |
| InChI | InChI=1S/C18H26ClN3O3/c1-3-5-17(23)21-10-12-6-4-7-22(11-12)18(24)13-8-14(19)15(20)9-16(13)25-2/h8-9,12H,3-7,10-11,20H2,1-2H3,(H,21,23) |
| InChIKey | ORWGFVQNVMFNSE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|